C15H24O3 — CID 132500218
(1S,2S,4R,5S,10R)-2,10-dihydroxy-1,8-dimethyl-4-propan-2-ylspiro[4.5]dec-8-en-7-one (PubChem CID 132500218) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is (1S,2S,4R,5S,10R)-2,10-dihydroxy-1,8-dimethyl-4-propan-2-ylspiro[4.5]dec-8-en-7-one.
| Compound Name | (1S,2S,4R,5S,10R)-2,10-dihydroxy-1,8-dimethyl-4-propan-2-ylspiro[4.5]dec-8-en-7-one |
|---|---|
| PubChem CID | 132500218 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | (1S,2S,4R,5S,10R)-2,10-dihydroxy-1,8-dimethyl-4-propan-2-ylspiro[4.5]dec-8-en-7-one |
| SMILES | CC1=C[C@@H](O)[C@@]2(CC1=O)[C@@H](C(C)C)C[C@H](O)[C@H]2C |
| InChI | InChI=1S/C15H24O3/c1-8(2)11-6-12(16)10(4)15(11)7-13(17)9(3)5-14(15)18/h5,8,10-12,14,16,18H,6-7H2,1-4H3/t10-,11-,12+,14-,15-/m1/s1 |
| InChIKey | IRHOLWCLSBJOSB-GGUBGCTKSA-N |
| XLogP | 1.93 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |