3,5-bis[2-(2-azidoethoxy)ethoxy]benzoic acid

C15H20N6O6 — CID 132500330

IUPAC3,5-bis[2-(2-azidoethoxy)ethoxy]benzoic acid
SMILES[N-]=[N+]=NCCOCCOc1cc(OCCOCCN=[N+]=[N-])cc(C(=O)O)c1
InChIInChI=1S/C15H20N6O6/c16-20-18-1-3-24-5-7-26-13-9-12(15(22)23)10-14(11-13)27-8-6-25-4-2-19-21-17/h9-11H,1-8H2,(H,22,23)
InChIKeyNCNMTFWUXIWYGE-UHFFFAOYSA-N
MW380.36 g/mol
LogP2.80
Rot. Bonds15

About 3,5-bis[2-(2-azidoethoxy)ethoxy]benzoic acid

3,5-bis[2-(2-azidoethoxy)ethoxy]benzoic acid (PubChem CID 132500330) has the molecular formula C15H20N6O6 and a molecular weight of 380.36 g/mol. Its IUPAC name is 3,5-bis[2-(2-azidoethoxy)ethoxy]benzoic acid.

Molecular Properties

Compound Name3,5-bis[2-(2-azidoethoxy)ethoxy]benzoic acid
PubChem CID132500330
Molecular FormulaC15H20N6O6
Molecular Weight380.36 g/mol
Exact Mass380.14
IUPAC Name3,5-bis[2-(2-azidoethoxy)ethoxy]benzoic acid
SMILES[N-]=[N+]=NCCOCCOc1cc(OCCOCCN=[N+]=[N-])cc(C(=O)O)c1
InChIInChI=1S/C15H20N6O6/c16-20-18-1-3-24-5-7-26-13-9-12(15(22)23)10-14(11-13)27-8-6-25-4-2-19-21-17/h9-11H,1-8H2,(H,22,23)
InChIKeyNCNMTFWUXIWYGE-UHFFFAOYSA-N
XLogP2.80
TPSA171.74 Ų
H-Bond Donors1
H-Bond Acceptors7
Rotatable Bonds15
Heavy Atoms27
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500380.36
LogP ≤ 52.80
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 107

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}

Analyze 3,5-bis[2-(2-azidoethoxy)ethoxy]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,5-bis[2-(2-azidoethoxy)ethoxy]benzoic acid?
The IUPAC name of 3,5-bis[2-(2-azidoethoxy)ethoxy]benzoic acid (CID 132500330) is 3,5-bis[2-(2-azidoethoxy)ethoxy]benzoic acid.
What is the SMILES notation for 3,5-bis[2-(2-azidoethoxy)ethoxy]benzoic acid?
The canonical SMILES for 3,5-bis[2-(2-azidoethoxy)ethoxy]benzoic acid is [N-]=[N+]=NCCOCCOc1cc(OCCOCCN=[N+]=[N-])cc(C(=O)O)c1.
What is the InChIKey of 3,5-bis[2-(2-azidoethoxy)ethoxy]benzoic acid?
The InChIKey is NCNMTFWUXIWYGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N6O6/c16-20-18-1-3-24-5-7-26-13-9-12(15(22)23)10-14(11-13)27-8-6-25-4-2-19-21-17/h9-11H,1-8H2,(H,22,23).
What are the key properties of 3,5-bis[2-(2-azidoethoxy)ethoxy]benzoic acid?
3,5-bis[2-(2-azidoethoxy)ethoxy]benzoic acid has a molecular weight of 380.36 g/mol, XLogP of 2.80, 15 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-bis[2-(2-azidoethoxy)ethoxy]benzoic acid is sourced from PubChem (CID 132500330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).