C15H20N6O6 — CID 132500330
3,5-bis[2-(2-azidoethoxy)ethoxy]benzoic acid (PubChem CID 132500330) has the molecular formula C15H20N6O6 and a molecular weight of 380.36 g/mol. Its IUPAC name is 3,5-bis[2-(2-azidoethoxy)ethoxy]benzoic acid.
| Compound Name | 3,5-bis[2-(2-azidoethoxy)ethoxy]benzoic acid |
|---|---|
| PubChem CID | 132500330 |
| Molecular Formula | C15H20N6O6 |
| Molecular Weight | 380.36 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | 3,5-bis[2-(2-azidoethoxy)ethoxy]benzoic acid |
| SMILES | [N-]=[N+]=NCCOCCOc1cc(OCCOCCN=[N+]=[N-])cc(C(=O)O)c1 |
| InChI | InChI=1S/C15H20N6O6/c16-20-18-1-3-24-5-7-26-13-9-12(15(22)23)10-14(11-13)27-8-6-25-4-2-19-21-17/h9-11H,1-8H2,(H,22,23) |
| InChIKey | NCNMTFWUXIWYGE-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 171.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.36 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|