C16H23F3N2O2 — CID 132500403
tert-butyl N-[(1S)-3-methyl-1-[6-(trifluoromethyl)-3-pyridinyl]butyl]carbamate (PubChem CID 132500403) has the molecular formula C16H23F3N2O2 and a molecular weight of 332.37 g/mol. Its IUPAC name is tert-butyl N-[(1S)-3-methyl-1-[6-(trifluoromethyl)-3-pyridinyl]butyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-3-methyl-1-[6-(trifluoromethyl)-3-pyridinyl]butyl]carbamate |
|---|---|
| PubChem CID | 132500403 |
| Molecular Formula | C16H23F3N2O2 |
| Molecular Weight | 332.37 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | tert-butyl N-[(1S)-3-methyl-1-[6-(trifluoromethyl)-3-pyridinyl]butyl]carbamate |
| SMILES | CC(C)C[C@H](NC(=O)OC(C)(C)C)c1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C16H23F3N2O2/c1-10(2)8-12(21-14(22)23-15(3,4)5)11-6-7-13(20-9-11)16(17,18)19/h6-7,9-10,12H,8H2,1-5H3,(H,21,22)/t12-/m0/s1 |
| InChIKey | JIBTZRAXBULRQI-LBPRGKRZSA-N |
| XLogP | 4.71 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.37 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |