C33H37NO7SSi — CID 132500471
[(2R,3R,4R,5R,6S)-4-[tert-butyl(dimethyl)silyl]peroxy-5-(1,3-dioxoisoindol-2-yl)-2-methyl-6-phenylsulfanyloxan-3-yl] benzoate (PubChem CID 132500471) has the molecular formula C33H37NO7SSi and a molecular weight of 619.81 g/mol. Its IUPAC name is [(2R,3R,4R,5R,6S)-4-[tert-butyl(dimethyl)silyl]peroxy-5-(1,3-dioxoisoindol-2-yl)-2-methyl-6-phenylsulfanyloxan-3-yl] benzoate.
| Compound Name | [(2R,3R,4R,5R,6S)-4-[tert-butyl(dimethyl)silyl]peroxy-5-(1,3-dioxoisoindol-2-yl)-2-methyl-6-phenylsulfanyloxan-3-yl] benzoate |
|---|---|
| PubChem CID | 132500471 |
| Molecular Formula | C33H37NO7SSi |
| Molecular Weight | 619.81 g/mol |
| Exact Mass | 619.21 |
| IUPAC Name | [(2R,3R,4R,5R,6S)-4-[tert-butyl(dimethyl)silyl]peroxy-5-(1,3-dioxoisoindol-2-yl)-2-methyl-6-phenylsulfanyloxan-3-yl] benzoate |
| SMILES | C[C@H]1O[C@@H](Sc2ccccc2)[C@H](N2C(=O)c3ccccc3C2=O)[C@@H](OO[Si](C)(C)C(C)(C)C)[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C33H37NO7SSi/c1-21-27(39-31(37)22-15-9-7-10-16-22)28(40-41-43(5,6)33(2,3)4)26(32(38-21)42-23-17-11-8-12-18-23)34-29(35)24-19-13-14-20-25(24)30(34)36/h7-21,26-28,32H,1-6H3/t21-,26-,27-,28-,32+/m1/s1 |
| InChIKey | MONXKHSMBLGOHB-FVVKKCTHSA-N |
| XLogP | 6.74 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.81 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|