C23H26O4 — CID 132500777
7,13-dioxatetracyclo[17.2.2.12,6.114,18]pentacosa-2(25),3,5,14,16,18(24),20-heptaene-1,19-diol (PubChem CID 132500777) has the molecular formula C23H26O4 and a molecular weight of 366.46 g/mol. Its IUPAC name is 7,13-dioxatetracyclo[17.2.2.12,6.114,18]pentacosa-2(25),3,5,14,16,18(24),20-heptaene-1,19-diol.
| Compound Name | 7,13-dioxatetracyclo[17.2.2.12,6.114,18]pentacosa-2(25),3,5,14,16,18(24),20-heptaene-1,19-diol |
|---|---|
| PubChem CID | 132500777 |
| Molecular Formula | C23H26O4 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | 7,13-dioxatetracyclo[17.2.2.12,6.114,18]pentacosa-2(25),3,5,14,16,18(24),20-heptaene-1,19-diol |
| SMILES | OC12C=CC(O)(CC1)c1cccc(c1)OCCCCCOc1cccc2c1 |
| InChI | InChI=1S/C23H26O4/c24-22-10-12-23(25,13-11-22)19-7-5-9-21(17-19)27-15-3-1-2-14-26-20-8-4-6-18(22)16-20/h4-10,12,16-17,24-25H,1-3,11,13-15H2 |
| InChIKey | DVMWCCSYCNIXRC-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|