C24H27NO3 — CID 132500908
(1S,3R)-5-(4,5-dimethoxy-7-methylnaphthalen-1-yl)-1,3-dimethyl-1,2,3,4-tetrahydroisoquinolin-8-ol (PubChem CID 132500908) has the molecular formula C24H27NO3 and a molecular weight of 377.48 g/mol. Its IUPAC name is (1S,3R)-5-(4,5-dimethoxy-7-methylnaphthalen-1-yl)-1,3-dimethyl-1,2,3,4-tetrahydroisoquinolin-8-ol.
| Compound Name | (1S,3R)-5-(4,5-dimethoxy-7-methylnaphthalen-1-yl)-1,3-dimethyl-1,2,3,4-tetrahydroisoquinolin-8-ol |
|---|---|
| PubChem CID | 132500908 |
| Molecular Formula | C24H27NO3 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | (1S,3R)-5-(4,5-dimethoxy-7-methylnaphthalen-1-yl)-1,3-dimethyl-1,2,3,4-tetrahydroisoquinolin-8-ol |
| SMILES | COc1ccc(-c2ccc(O)c3c2C[C@@H](C)N[C@H]3C)c2cc(C)cc(OC)c12 |
| InChI | InChI=1S/C24H27NO3/c1-13-10-18-17(7-9-21(27-4)24(18)22(11-13)28-5)16-6-8-20(26)23-15(3)25-14(2)12-19(16)23/h6-11,14-15,25-26H,12H2,1-5H3/t14-,15+/m1/s1 |
| InChIKey | ZJJPBMLFLTUEDN-CABCVRRESA-N |
| XLogP | 5.13 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|