C14H19FN2O6S — CID 132501061
propan-2-yl N-(4-fluorophenyl)sulfonyl-N-(propan-2-yloxycarbonylamino)carbamate (PubChem CID 132501061) has the molecular formula C14H19FN2O6S and a molecular weight of 362.38 g/mol. Its IUPAC name is propan-2-yl N-(4-fluorophenyl)sulfonyl-N-(propan-2-yloxycarbonylamino)carbamate.
| Compound Name | propan-2-yl N-(4-fluorophenyl)sulfonyl-N-(propan-2-yloxycarbonylamino)carbamate |
|---|---|
| PubChem CID | 132501061 |
| Molecular Formula | C14H19FN2O6S |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | propan-2-yl N-(4-fluorophenyl)sulfonyl-N-(propan-2-yloxycarbonylamino)carbamate |
| SMILES | CC(C)OC(=O)NN(C(=O)OC(C)C)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H19FN2O6S/c1-9(2)22-13(18)16-17(14(19)23-10(3)4)24(20,21)12-7-5-11(15)6-8-12/h5-10H,1-4H3,(H,16,18) |
| InChIKey | HHTFGCQZSQFPEA-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|