About (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2,5-dimethylhexanal
(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2,5-dimethylhexanal (PubChem CID 132501470) has the molecular formula C14H30O2Si
and a molecular weight of 258.48 g/mol. Its IUPAC name is (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2,5-dimethylhexanal.
Molecular Properties
| Compound Name | (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2,5-dimethylhexanal |
| PubChem CID | 132501470 |
| Molecular Formula | C14H30O2Si |
| Molecular Weight | 258.48 g/mol |
| Exact Mass | 258.20 |
| IUPAC Name | (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2,5-dimethylhexanal |
| SMILES | CC(C)C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C=O |
| InChI | InChI=1S/C14H30O2Si/c1-11(2)9-13(12(3)10-15)16-17(7,8)14(4,5)6/h10-13H,9H2,1-8H3/t12-,13-/m0/s1 |
| InChIKey | GDJQBIZIIYNERB-STQMWFEESA-N |
| XLogP | 4.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.48 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2,5-dimethylhexanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2,5-dimethylhexanal?
The IUPAC name of (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2,5-dimethylhexanal (CID 132501470) is (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2,5-dimethylhexanal.
What is the SMILES notation for (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2,5-dimethylhexanal?
The canonical SMILES for (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2,5-dimethylhexanal is CC(C)C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C=O.
What is the InChIKey of (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2,5-dimethylhexanal?
The InChIKey is GDJQBIZIIYNERB-STQMWFEESA-N. The full InChI is InChI=1S/C14H30O2Si/c1-11(2)9-13(12(3)10-15)16-17(7,8)14(4,5)6/h10-13H,9H2,1-8H3/t12-,13-/m0/s1.
What are the key properties of (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2,5-dimethylhexanal?
(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2,5-dimethylhexanal has a molecular weight of 258.48 g/mol, XLogP of 4.26, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2,5-dimethylhexanal is sourced from PubChem (CID 132501470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).