C14H19ClO — CID 132501482
(3S,4R)-3,4-diethyltricyclo[4.2.1.02,5]non-7-ene-3-carbonyl chloride (PubChem CID 132501482) has the molecular formula C14H19ClO and a molecular weight of 238.76 g/mol. Its IUPAC name is (3S,4R)-3,4-diethyltricyclo[4.2.1.02,5]non-7-ene-3-carbonyl chloride.
| Compound Name | (3S,4R)-3,4-diethyltricyclo[4.2.1.02,5]non-7-ene-3-carbonyl chloride |
|---|---|
| PubChem CID | 132501482 |
| Molecular Formula | C14H19ClO |
| Molecular Weight | 238.76 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | (3S,4R)-3,4-diethyltricyclo[4.2.1.02,5]non-7-ene-3-carbonyl chloride |
| SMILES | CCC1C2C3C=CC(C3)C2C1(CC)C(=O)Cl |
| InChI | InChI=1S/C14H19ClO/c1-3-10-11-8-5-6-9(7-8)12(11)14(10,4-2)13(15)16/h5-6,8-12H,3-4,7H2,1-2H3 |
| InChIKey | NPLCWLNCJZAAPJ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.76 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|