About (2S,6R)-tricyclo[5.2.1.02,6]dec-8-en-3-one
(2S,6R)-tricyclo[5.2.1.02,6]dec-8-en-3-one (PubChem CID 132501551) has the molecular formula C10H12O
and a molecular weight of 148.21 g/mol. Its IUPAC name is (2S,6R)-tricyclo[5.2.1.02,6]dec-8-en-3-one.
Molecular Properties
| Compound Name | (2S,6R)-tricyclo[5.2.1.02,6]dec-8-en-3-one |
| PubChem CID | 132501551 |
| Molecular Formula | C10H12O |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.09 |
| IUPAC Name | (2S,6R)-tricyclo[5.2.1.02,6]dec-8-en-3-one |
| SMILES | O=C1CC[C@@H]2C3C=CC(C3)[C@H]12 |
| InChI | InChI=1S/C10H12O/c11-9-4-3-8-6-1-2-7(5-6)10(8)9/h1-2,6-8,10H,3-5H2/t6?,7?,8-,10+/m1/s1 |
| InChIKey | NDZKBCKGQBZZFM-VUMZSGCYSA-N |
| XLogP | 1.79 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2S,6R)-tricyclo[5.2.1.02,6]dec-8-en-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,6R)-tricyclo[5.2.1.02,6]dec-8-en-3-one?
The IUPAC name of (2S,6R)-tricyclo[5.2.1.02,6]dec-8-en-3-one (CID 132501551) is (2S,6R)-tricyclo[5.2.1.02,6]dec-8-en-3-one.
What is the SMILES notation for (2S,6R)-tricyclo[5.2.1.02,6]dec-8-en-3-one?
The canonical SMILES for (2S,6R)-tricyclo[5.2.1.02,6]dec-8-en-3-one is O=C1CC[C@@H]2C3C=CC(C3)[C@H]12.
What is the InChIKey of (2S,6R)-tricyclo[5.2.1.02,6]dec-8-en-3-one?
The InChIKey is NDZKBCKGQBZZFM-VUMZSGCYSA-N. The full InChI is InChI=1S/C10H12O/c11-9-4-3-8-6-1-2-7(5-6)10(8)9/h1-2,6-8,10H,3-5H2/t6?,7?,8-,10+/m1/s1.
What are the key properties of (2S,6R)-tricyclo[5.2.1.02,6]dec-8-en-3-one?
(2S,6R)-tricyclo[5.2.1.02,6]dec-8-en-3-one has a molecular weight of 148.21 g/mol, XLogP of 1.79, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,6R)-tricyclo[5.2.1.02,6]dec-8-en-3-one is sourced from PubChem (CID 132501551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).