About [1-[(2R)-1-(2,6-dioxo-3H-purin-9-yl)-3-hydroxypropan-2-yl]triazol-4-yl]phosphonic acid
[1-[(2R)-1-(2,6-dioxo-3H-purin-9-yl)-3-hydroxypropan-2-yl]triazol-4-yl]phosphonic acid (PubChem CID 132501768) has the molecular formula C10H12N7O6P
and a molecular weight of 357.22 g/mol. Its IUPAC name is [1-[(2R)-1-(2,6-dioxo-3H-purin-9-yl)-3-hydroxypropan-2-yl]triazol-4-yl]phosphonic acid.
Molecular Properties
| Compound Name | [1-[(2R)-1-(2,6-dioxo-3H-purin-9-yl)-3-hydroxypropan-2-yl]triazol-4-yl]phosphonic acid |
| PubChem CID | 132501768 |
| Molecular Formula | C10H12N7O6P |
| Molecular Weight | 357.22 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | [1-[(2R)-1-(2,6-dioxo-3H-purin-9-yl)-3-hydroxypropan-2-yl]triazol-4-yl]phosphonic acid |
| SMILES | O=c1[nH]c(=O)c2ncn(C[C@H](CO)n3cc(P(=O)(O)O)nn3)c2[nH]1 |
| InChI | InChI=1S/C10H12N7O6P/c18-3-5(17-2-6(14-15-17)24(21,22)23)1-16-4-11-7-8(16)12-10(20)13-9(7)19/h2,4-5,18H,1,3H2,(H2,21,22,23)(H2,12,13,19,20)/t5-/m1/s1 |
| InChIKey | WCWKSYDPSRYDCU-RXMQYKEDSA-N |
| XLogP | -2.96 |
| TPSA | 192.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.22 |
| LogP ≤ 5 | -2.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [1-[(2R)-1-(2,6-dioxo-3H-purin-9-yl)-3-hydroxypropan-2-yl]triazol-4-yl]phosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(2R)-1-(2,6-dioxo-3H-purin-9-yl)-3-hydroxypropan-2-yl]triazol-4-yl]phosphonic acid?
The IUPAC name of [1-[(2R)-1-(2,6-dioxo-3H-purin-9-yl)-3-hydroxypropan-2-yl]triazol-4-yl]phosphonic acid (CID 132501768) is [1-[(2R)-1-(2,6-dioxo-3H-purin-9-yl)-3-hydroxypropan-2-yl]triazol-4-yl]phosphonic acid.
What is the SMILES notation for [1-[(2R)-1-(2,6-dioxo-3H-purin-9-yl)-3-hydroxypropan-2-yl]triazol-4-yl]phosphonic acid?
The canonical SMILES for [1-[(2R)-1-(2,6-dioxo-3H-purin-9-yl)-3-hydroxypropan-2-yl]triazol-4-yl]phosphonic acid is O=c1[nH]c(=O)c2ncn(C[C@H](CO)n3cc(P(=O)(O)O)nn3)c2[nH]1.
What is the InChIKey of [1-[(2R)-1-(2,6-dioxo-3H-purin-9-yl)-3-hydroxypropan-2-yl]triazol-4-yl]phosphonic acid?
The InChIKey is WCWKSYDPSRYDCU-RXMQYKEDSA-N. The full InChI is InChI=1S/C10H12N7O6P/c18-3-5(17-2-6(14-15-17)24(21,22)23)1-16-4-11-7-8(16)12-10(20)13-9(7)19/h2,4-5,18H,1,3H2,(H2,21,22,23)(H2,12,13,19,20)/t5-/m1/s1.
What are the key properties of [1-[(2R)-1-(2,6-dioxo-3H-purin-9-yl)-3-hydroxypropan-2-yl]triazol-4-yl]phosphonic acid?
[1-[(2R)-1-(2,6-dioxo-3H-purin-9-yl)-3-hydroxypropan-2-yl]triazol-4-yl]phosphonic acid has a molecular weight of 357.22 g/mol, XLogP of -2.96, 5 rotatable bonds, 5 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(2R)-1-(2,6-dioxo-3H-purin-9-yl)-3-hydroxypropan-2-yl]triazol-4-yl]phosphonic acid is sourced from PubChem (CID 132501768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).