C17H9FOS — CID 132501805
9-(4-fluorophenyl)-2-thiatricyclo[6.3.1.04,12]dodeca-1(12),4,6,8,10-pentaen-3-one (PubChem CID 132501805) has the molecular formula C17H9FOS and a molecular weight of 280.32 g/mol. Its IUPAC name is 9-(4-fluorophenyl)-2-thiatricyclo[6.3.1.04,12]dodeca-1(12),4,6,8,10-pentaen-3-one.
| Compound Name | 9-(4-fluorophenyl)-2-thiatricyclo[6.3.1.04,12]dodeca-1(12),4,6,8,10-pentaen-3-one |
|---|---|
| PubChem CID | 132501805 |
| Molecular Formula | C17H9FOS |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | 9-(4-fluorophenyl)-2-thiatricyclo[6.3.1.04,12]dodeca-1(12),4,6,8,10-pentaen-3-one |
| SMILES | O=C1Sc2ccc(-c3ccc(F)cc3)c3cccc1c23 |
| InChI | InChI=1S/C17H9FOS/c18-11-6-4-10(5-7-11)12-8-9-15-16-13(12)2-1-3-14(16)17(19)20-15/h1-9H |
| InChIKey | VNZUTRRNORPTJX-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|