C19H22NO5P — CID 132502408
(3R)-3-diethoxyphosphoryl-3-(4-methoxyphenyl)-2H-isoindol-1-one (PubChem CID 132502408) has the molecular formula C19H22NO5P and a molecular weight of 375.36 g/mol. Its IUPAC name is (3R)-3-diethoxyphosphoryl-3-(4-methoxyphenyl)-2H-isoindol-1-one.
| Compound Name | (3R)-3-diethoxyphosphoryl-3-(4-methoxyphenyl)-2H-isoindol-1-one |
|---|---|
| PubChem CID | 132502408 |
| Molecular Formula | C19H22NO5P |
| Molecular Weight | 375.36 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | (3R)-3-diethoxyphosphoryl-3-(4-methoxyphenyl)-2H-isoindol-1-one |
| SMILES | CCOP(=O)(OCC)[C@@]1(c2ccc(OC)cc2)NC(=O)c2ccccc21 |
| InChI | InChI=1S/C19H22NO5P/c1-4-24-26(22,25-5-2)19(14-10-12-15(23-3)13-11-14)17-9-7-6-8-16(17)18(21)20-19/h6-13H,4-5H2,1-3H3,(H,20,21)/t19-/m1/s1 |
| InChIKey | FGHFEDRBKNLIMN-LJQANCHMSA-N |
| XLogP | 3.91 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.36 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|