C48H46B2O4 — CID 132503550
3,9-ditert-butyl-14,30-diphenyl-13,15,29,31-tetraoxa-14,30-diboraheptacyclo[25.5.1.111,17.05,32.07,12.016,21.023,28]tetratriaconta-1(32),2,4,7,9,11,16(21),17,19,23(28),24,26-dodecaene (PubChem CID 132503550) has the molecular formula C48H46B2O4 and a molecular weight of 708.52 g/mol. Its IUPAC name is 3,9-ditert-butyl-14,30-diphenyl-13,15,29,31-tetraoxa-14,30-diboraheptacyclo[25.5.1.111,17.05,32.07,12.016,21.023,28]tetratriaconta-1(32),2,4,7,9,11,16(21),17,19,23(28),24,26-dodecaene.
| Compound Name | 3,9-ditert-butyl-14,30-diphenyl-13,15,29,31-tetraoxa-14,30-diboraheptacyclo[25.5.1.111,17.05,32.07,12.016,21.023,28]tetratriaconta-1(32),2,4,7,9,11,16(21),17,19,23(28),24,26-dodecaene |
|---|---|
| PubChem CID | 132503550 |
| Molecular Formula | C48H46B2O4 |
| Molecular Weight | 708.52 g/mol |
| Exact Mass | 708.36 |
| IUPAC Name | 3,9-ditert-butyl-14,30-diphenyl-13,15,29,31-tetraoxa-14,30-diboraheptacyclo[25.5.1.111,17.05,32.07,12.016,21.023,28]tetratriaconta-1(32),2,4,7,9,11,16(21),17,19,23(28),24,26-dodecaene |
| SMILES | CC(C)(C)c1cc2c3c(c1)Cc1cc(C(C)(C)C)cc4c1OB(c1ccccc1)Oc1c(cccc1C4)Cc1cccc(c1OB(c1ccccc1)O3)C2 |
| InChI | InChI=1S/C48H46B2O4/c1-47(2,3)39-27-35-24-33-17-13-15-31-23-32-16-14-18-34-25-36-28-40(48(4,5)6)30-38(46(36)54-50(52-44(32)34)42-21-11-8-12-22-42)26-37(29-39)45(35)53-49(51-43(31)33)41-19-9-7-10-20-41/h7-22,27-30H,23-26H2,1-6H3 |
| InChIKey | LVRLAQFGUCNIJP-UHFFFAOYSA-N |
| XLogP | 9.29 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.52 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|