C17H13NS — CID 132503643
4-(2-methylphenyl)thieno[3,4-b]indole (PubChem CID 132503643) has the molecular formula C17H13NS and a molecular weight of 263.37 g/mol. Its IUPAC name is 4-(2-methylphenyl)thieno[3,4-b]indole.
| Compound Name | 4-(2-methylphenyl)thieno[3,4-b]indole |
|---|---|
| PubChem CID | 132503643 |
| Molecular Formula | C17H13NS |
| Molecular Weight | 263.37 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | 4-(2-methylphenyl)thieno[3,4-b]indole |
| SMILES | Cc1ccccc1-n1c2ccccc2c2cscc21 |
| InChI | InChI=1S/C17H13NS/c1-12-6-2-4-8-15(12)18-16-9-5-3-7-13(16)14-10-19-11-17(14)18/h2-11H,1H3 |
| InChIKey | JDGCCIZPLPCHNM-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.37 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |