C46H22Br2F24O2P2 — CID 132503950
[2-[2-bis[3,5-bis(trifluoromethyl)phenyl]phosphanyl-3-bromo-6-methoxyphenyl]-6-bromo-3-methoxyphenyl]-bis[3,5-bis(trifluoromethyl)phenyl]phosphane (PubChem CID 132503950) has the molecular formula C46H22Br2F24O2P2 and a molecular weight of 1284.39 g/mol. Its IUPAC name is [2-[2-bis[3,5-bis(trifluoromethyl)phenyl]phosphanyl-3-bromo-6-methoxyphenyl]-6-bromo-3-methoxyphenyl]-bis[3,5-bis(trifluoromethyl)phenyl]phosphane.
| Compound Name | [2-[2-bis[3,5-bis(trifluoromethyl)phenyl]phosphanyl-3-bromo-6-methoxyphenyl]-6-bromo-3-methoxyphenyl]-bis[3,5-bis(trifluoromethyl)phenyl]phosphane |
|---|---|
| PubChem CID | 132503950 |
| Molecular Formula | C46H22Br2F24O2P2 |
| Molecular Weight | 1284.39 g/mol |
| Exact Mass | 1281.91 |
| IUPAC Name | [2-[2-bis[3,5-bis(trifluoromethyl)phenyl]phosphanyl-3-bromo-6-methoxyphenyl]-6-bromo-3-methoxyphenyl]-bis[3,5-bis(trifluoromethyl)phenyl]phosphane |
| SMILES | COc1ccc(Br)c(P(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c1-c1c(OC)ccc(Br)c1P(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C46H22Br2F24O2P2/c1-73-33-5-3-31(47)37(75(27-11-19(39(49,50)51)7-20(12-27)40(52,53)54)28-13-21(41(55,56)57)8-22(14-28)42(58,59)60)35(33)36-34(74-2)6-4-32(48)38(36)76(29-15-23(43(61,62)63)9-24(16-29)44(64,65)66)30-17-25(45(67,68)69)10-26(18-30)46(70,71)72/h3-18H,1-2H3 |
| InChIKey | LRWILSJSHPOKDD-UHFFFAOYSA-N |
| XLogP | 16.56 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1284.39 |
| LogP ≤ 5 | 16.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|