About 2-phenyl-1,7-dihydropyrrolo[3,2-f]indole
2-phenyl-1,7-dihydropyrrolo[3,2-f]indole (PubChem CID 13250404) has the molecular formula C16H12N2
and a molecular weight of 232.29 g/mol. Its IUPAC name is 2-phenyl-1,7-dihydropyrrolo[3,2-f]indole.
Molecular Properties
| Compound Name | 2-phenyl-1,7-dihydropyrrolo[3,2-f]indole |
| PubChem CID | 13250404 |
| Molecular Formula | C16H12N2 |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 2-phenyl-1,7-dihydropyrrolo[3,2-f]indole |
| SMILES | c1ccc(-c2cc3cc4cc[nH]c4cc3[nH]2)cc1 |
| InChI | InChI=1S/C16H12N2/c1-2-4-11(5-3-1)15-9-13-8-12-6-7-17-14(12)10-16(13)18-15/h1-10,17-18H |
| InChIKey | GFUYAHXOKXDKCD-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-phenyl-1,7-dihydropyrrolo[3,2-f]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-1,7-dihydropyrrolo[3,2-f]indole?
The IUPAC name of 2-phenyl-1,7-dihydropyrrolo[3,2-f]indole (CID 13250404) is 2-phenyl-1,7-dihydropyrrolo[3,2-f]indole.
What is the SMILES notation for 2-phenyl-1,7-dihydropyrrolo[3,2-f]indole?
The canonical SMILES for 2-phenyl-1,7-dihydropyrrolo[3,2-f]indole is c1ccc(-c2cc3cc4cc[nH]c4cc3[nH]2)cc1.
What is the InChIKey of 2-phenyl-1,7-dihydropyrrolo[3,2-f]indole?
The InChIKey is GFUYAHXOKXDKCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N2/c1-2-4-11(5-3-1)15-9-13-8-12-6-7-17-14(12)10-16(13)18-15/h1-10,17-18H.
What are the key properties of 2-phenyl-1,7-dihydropyrrolo[3,2-f]indole?
2-phenyl-1,7-dihydropyrrolo[3,2-f]indole has a molecular weight of 232.29 g/mol, XLogP of 4.32, 1 rotatable bonds, 2 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-1,7-dihydropyrrolo[3,2-f]indole is sourced from PubChem (CID 13250404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).