C29H30FN3O3 — CID 132504121
(1S,2'S,6'R)-2'-(3,4-dimethoxyphenyl)-6'-(4-fluorophenyl)spiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,4'-piperidine]-6-ol (PubChem CID 132504121) has the molecular formula C29H30FN3O3 and a molecular weight of 487.58 g/mol. Its IUPAC name is (1S,2'S,6'R)-2'-(3,4-dimethoxyphenyl)-6'-(4-fluorophenyl)spiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,4'-piperidine]-6-ol.
| Compound Name | (1S,2'S,6'R)-2'-(3,4-dimethoxyphenyl)-6'-(4-fluorophenyl)spiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,4'-piperidine]-6-ol |
|---|---|
| PubChem CID | 132504121 |
| Molecular Formula | C29H30FN3O3 |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.23 |
| IUPAC Name | (1S,2'S,6'R)-2'-(3,4-dimethoxyphenyl)-6'-(4-fluorophenyl)spiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,4'-piperidine]-6-ol |
| SMILES | COc1ccc([C@@H]2C[C@]3(C[C@H](c4ccc(F)cc4)N2)NCCc2c3[nH]c3ccc(O)cc23)cc1OC |
| InChI | InChI=1S/C29H30FN3O3/c1-35-26-10-5-18(13-27(26)36-2)25-16-29(15-24(32-25)17-3-6-19(30)7-4-17)28-21(11-12-31-29)22-14-20(34)8-9-23(22)33-28/h3-10,13-14,24-25,31-34H,11-12,15-16H2,1-2H3/t24-,25+,29+/m1/s1 |
| InChIKey | KLEJDUHTBWEGCQ-AHPZMPFVSA-N |
| XLogP | 5.24 |
| TPSA | 78.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |