C26H14FN5OS — CID 132504205
13-anilino-17-(2-fluorophenyl)-2-oxo-12-thia-3,9,16-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),4,6,8,11(15),13,16-heptaene-14-carbonitrile (PubChem CID 132504205) has the molecular formula C26H14FN5OS and a molecular weight of 463.50 g/mol. Its IUPAC name is 13-anilino-17-(2-fluorophenyl)-2-oxo-12-thia-3,9,16-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),4,6,8,11(15),13,16-heptaene-14-carbonitrile.
| Compound Name | 13-anilino-17-(2-fluorophenyl)-2-oxo-12-thia-3,9,16-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),4,6,8,11(15),13,16-heptaene-14-carbonitrile |
|---|---|
| PubChem CID | 132504205 |
| Molecular Formula | C26H14FN5OS |
| Molecular Weight | 463.50 g/mol |
| Exact Mass | 463.09 |
| IUPAC Name | 13-anilino-17-(2-fluorophenyl)-2-oxo-12-thia-3,9,16-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),4,6,8,11(15),13,16-heptaene-14-carbonitrile |
| SMILES | N#Cc1c(Nc2ccccc2)sc2c1nc(-c1ccccc1F)c1c(=O)n3ccccc3nc12 |
| InChI | InChI=1S/C26H14FN5OS/c27-18-11-5-4-10-16(18)21-20-23(30-19-12-6-7-13-32(19)26(20)33)24-22(31-21)17(14-28)25(34-24)29-15-8-2-1-3-9-15/h1-13,29H |
| InChIKey | CQAZYFXWNOUDLL-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 83.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.50 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|