C27H18F8NOP — CID 132504754
2,3,4,5,6-pentafluoro-N-[(3-methylphenyl)-[5-methyl-2-[4-(trifluoromethyl)phenyl]phenyl]phosphoryl]aniline (PubChem CID 132504754) has the molecular formula C27H18F8NOP and a molecular weight of 555.41 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-[(3-methylphenyl)-[5-methyl-2-[4-(trifluoromethyl)phenyl]phenyl]phosphoryl]aniline.
| Compound Name | 2,3,4,5,6-pentafluoro-N-[(3-methylphenyl)-[5-methyl-2-[4-(trifluoromethyl)phenyl]phenyl]phosphoryl]aniline |
|---|---|
| PubChem CID | 132504754 |
| Molecular Formula | C27H18F8NOP |
| Molecular Weight | 555.41 g/mol |
| Exact Mass | 555.10 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-[(3-methylphenyl)-[5-methyl-2-[4-(trifluoromethyl)phenyl]phenyl]phosphoryl]aniline |
| SMILES | Cc1cccc(P(=O)(Nc2c(F)c(F)c(F)c(F)c2F)c2cc(C)ccc2-c2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C27H18F8NOP/c1-14-4-3-5-18(12-14)38(37,36-26-24(31)22(29)21(28)23(30)25(26)32)20-13-15(2)6-11-19(20)16-7-9-17(10-8-16)27(33,34)35/h3-13H,1-2H3,(H,36,37) |
| InChIKey | LMYFKCPZAPLZOH-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.41 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|