About 2-methyl-N-[(2R)-1,1,1-trifluoropropan-2-yl]propane-2-sulfinamide
2-methyl-N-[(2R)-1,1,1-trifluoropropan-2-yl]propane-2-sulfinamide (PubChem CID 132504791) has the molecular formula C7H14F3NOS
and a molecular weight of 217.26 g/mol. Its IUPAC name is 2-methyl-N-[(2R)-1,1,1-trifluoropropan-2-yl]propane-2-sulfinamide.
Molecular Properties
| Compound Name | 2-methyl-N-[(2R)-1,1,1-trifluoropropan-2-yl]propane-2-sulfinamide |
| PubChem CID | 132504791 |
| Molecular Formula | C7H14F3NOS |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 2-methyl-N-[(2R)-1,1,1-trifluoropropan-2-yl]propane-2-sulfinamide |
| SMILES | C[C@@H](NS(=O)C(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C7H14F3NOS/c1-5(7(8,9)10)11-13(12)6(2,3)4/h5,11H,1-4H3/t5-,13?/m1/s1 |
| InChIKey | CVHUSJRMKLNCST-LJYRTBSXSA-N |
| XLogP | 1.99 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methyl-N-[(2R)-1,1,1-trifluoropropan-2-yl]propane-2-sulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N-[(2R)-1,1,1-trifluoropropan-2-yl]propane-2-sulfinamide?
The IUPAC name of 2-methyl-N-[(2R)-1,1,1-trifluoropropan-2-yl]propane-2-sulfinamide (CID 132504791) is 2-methyl-N-[(2R)-1,1,1-trifluoropropan-2-yl]propane-2-sulfinamide.
What is the SMILES notation for 2-methyl-N-[(2R)-1,1,1-trifluoropropan-2-yl]propane-2-sulfinamide?
The canonical SMILES for 2-methyl-N-[(2R)-1,1,1-trifluoropropan-2-yl]propane-2-sulfinamide is C[C@@H](NS(=O)C(C)(C)C)C(F)(F)F.
What is the InChIKey of 2-methyl-N-[(2R)-1,1,1-trifluoropropan-2-yl]propane-2-sulfinamide?
The InChIKey is CVHUSJRMKLNCST-LJYRTBSXSA-N. The full InChI is InChI=1S/C7H14F3NOS/c1-5(7(8,9)10)11-13(12)6(2,3)4/h5,11H,1-4H3/t5-,13?/m1/s1.
What are the key properties of 2-methyl-N-[(2R)-1,1,1-trifluoropropan-2-yl]propane-2-sulfinamide?
2-methyl-N-[(2R)-1,1,1-trifluoropropan-2-yl]propane-2-sulfinamide has a molecular weight of 217.26 g/mol, XLogP of 1.99, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N-[(2R)-1,1,1-trifluoropropan-2-yl]propane-2-sulfinamide is sourced from PubChem (CID 132504791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).