C18H19N5O4 — CID 132505191
ethyl N-(ethoxycarbonylamino)-N-(2-phenylimidazo[1,2-a]pyrimidin-3-yl)carbamate (PubChem CID 132505191) has the molecular formula C18H19N5O4 and a molecular weight of 369.38 g/mol. Its IUPAC name is ethyl N-(ethoxycarbonylamino)-N-(2-phenylimidazo[1,2-a]pyrimidin-3-yl)carbamate.
| Compound Name | ethyl N-(ethoxycarbonylamino)-N-(2-phenylimidazo[1,2-a]pyrimidin-3-yl)carbamate |
|---|---|
| PubChem CID | 132505191 |
| Molecular Formula | C18H19N5O4 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | ethyl N-(ethoxycarbonylamino)-N-(2-phenylimidazo[1,2-a]pyrimidin-3-yl)carbamate |
| SMILES | CCOC(=O)NN(C(=O)OCC)c1c(-c2ccccc2)nc2ncccn12 |
| InChI | InChI=1S/C18H19N5O4/c1-3-26-17(24)21-23(18(25)27-4-2)15-14(13-9-6-5-7-10-13)20-16-19-11-8-12-22(15)16/h5-12H,3-4H2,1-2H3,(H,21,24) |
| InChIKey | MOPGDMKLTNCDLV-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 98.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|