C26H30F3NO4S — CID 132505850
tert-butyl N-(4-methylphenyl)sulfonyl-N-[3-methyl-5-phenyl-3-(2,2,2-trifluoroethyl)pent-4-ynyl]carbamate (PubChem CID 132505850) has the molecular formula C26H30F3NO4S and a molecular weight of 509.59 g/mol. Its IUPAC name is tert-butyl N-(4-methylphenyl)sulfonyl-N-[3-methyl-5-phenyl-3-(2,2,2-trifluoroethyl)pent-4-ynyl]carbamate.
| Compound Name | tert-butyl N-(4-methylphenyl)sulfonyl-N-[3-methyl-5-phenyl-3-(2,2,2-trifluoroethyl)pent-4-ynyl]carbamate |
|---|---|
| PubChem CID | 132505850 |
| Molecular Formula | C26H30F3NO4S |
| Molecular Weight | 509.59 g/mol |
| Exact Mass | 509.18 |
| IUPAC Name | tert-butyl N-(4-methylphenyl)sulfonyl-N-[3-methyl-5-phenyl-3-(2,2,2-trifluoroethyl)pent-4-ynyl]carbamate |
| SMILES | Cc1ccc(S(=O)(=O)N(CCC(C)(C#Cc2ccccc2)CC(F)(F)F)C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C26H30F3NO4S/c1-20-11-13-22(14-12-20)35(32,33)30(23(31)34-24(2,3)4)18-17-25(5,19-26(27,28)29)16-15-21-9-7-6-8-10-21/h6-14H,17-19H2,1-5H3 |
| InChIKey | HSKJMEPVWHNKQO-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.59 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|