C17H23NO — CID 132505922
(1R,5R,9R)-5-phenyl-7-oxa-6-azatricyclo[7.4.0.01,6]tridecane (PubChem CID 132505922) has the molecular formula C17H23NO and a molecular weight of 257.38 g/mol. Its IUPAC name is (1R,5R,9R)-5-phenyl-7-oxa-6-azatricyclo[7.4.0.01,6]tridecane.
| Compound Name | (1R,5R,9R)-5-phenyl-7-oxa-6-azatricyclo[7.4.0.01,6]tridecane |
|---|---|
| PubChem CID | 132505922 |
| Molecular Formula | C17H23NO |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | (1R,5R,9R)-5-phenyl-7-oxa-6-azatricyclo[7.4.0.01,6]tridecane |
| SMILES | c1ccc([C@H]2CCC[C@]34CCCC[C@H]3CON24)cc1 |
| InChI | InChI=1S/C17H23NO/c1-2-7-14(8-3-1)16-10-6-12-17-11-5-4-9-15(17)13-19-18(16)17/h1-3,7-8,15-16H,4-6,9-13H2/t15-,16+,17+/m0/s1 |
| InChIKey | PZUFSEYLBOBQFD-GVDBMIGSSA-N |
| XLogP | 4.09 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |