C22H21ClF3NO6S — CID 132506680
dimethyl 2-[(E,2S)-4-(3-chlorophenyl)-1,1,1-trifluoro-4-[(4-methylphenyl)sulfonylamino]but-3-en-2-yl]propanedioate (PubChem CID 132506680) has the molecular formula C22H21ClF3NO6S and a molecular weight of 519.93 g/mol. Its IUPAC name is dimethyl 2-[(E,2S)-4-(3-chlorophenyl)-1,1,1-trifluoro-4-[(4-methylphenyl)sulfonylamino]but-3-en-2-yl]propanedioate.
| Compound Name | dimethyl 2-[(E,2S)-4-(3-chlorophenyl)-1,1,1-trifluoro-4-[(4-methylphenyl)sulfonylamino]but-3-en-2-yl]propanedioate |
|---|---|
| PubChem CID | 132506680 |
| Molecular Formula | C22H21ClF3NO6S |
| Molecular Weight | 519.93 g/mol |
| Exact Mass | 519.07 |
| IUPAC Name | dimethyl 2-[(E,2S)-4-(3-chlorophenyl)-1,1,1-trifluoro-4-[(4-methylphenyl)sulfonylamino]but-3-en-2-yl]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)[C@H](/C=C(/NS(=O)(=O)c1ccc(C)cc1)c1cccc(Cl)c1)C(F)(F)F |
| InChI | InChI=1S/C22H21ClF3NO6S/c1-13-7-9-16(10-8-13)34(30,31)27-18(14-5-4-6-15(23)11-14)12-17(22(24,25)26)19(20(28)32-2)21(29)33-3/h4-12,17,19,27H,1-3H3/b18-12+/t17-/m0/s1 |
| InChIKey | CNEAJBLERRNDGC-BOFQVRIASA-N |
| XLogP | 4.11 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.93 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|