About 2-(4-bromophenyl)-3,4-dimethylfuran
2-(4-bromophenyl)-3,4-dimethylfuran (PubChem CID 132507630) has the molecular formula C12H11BrO
and a molecular weight of 251.12 g/mol. Its IUPAC name is 2-(4-bromophenyl)-3,4-dimethylfuran.
Molecular Properties
| Compound Name | 2-(4-bromophenyl)-3,4-dimethylfuran |
| PubChem CID | 132507630 |
| Molecular Formula | C12H11BrO |
| Molecular Weight | 251.12 g/mol |
| Exact Mass | 250.00 |
| IUPAC Name | 2-(4-bromophenyl)-3,4-dimethylfuran |
| SMILES | Cc1coc(-c2ccc(Br)cc2)c1C |
| InChI | InChI=1S/C12H11BrO/c1-8-7-14-12(9(8)2)10-3-5-11(13)6-4-10/h3-7H,1-2H3 |
| InChIKey | ANNGEVZONKTVTM-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.12 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(4-bromophenyl)-3,4-dimethylfuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-bromophenyl)-3,4-dimethylfuran?
The IUPAC name of 2-(4-bromophenyl)-3,4-dimethylfuran (CID 132507630) is 2-(4-bromophenyl)-3,4-dimethylfuran.
What is the SMILES notation for 2-(4-bromophenyl)-3,4-dimethylfuran?
The canonical SMILES for 2-(4-bromophenyl)-3,4-dimethylfuran is Cc1coc(-c2ccc(Br)cc2)c1C.
What is the InChIKey of 2-(4-bromophenyl)-3,4-dimethylfuran?
The InChIKey is ANNGEVZONKTVTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11BrO/c1-8-7-14-12(9(8)2)10-3-5-11(13)6-4-10/h3-7H,1-2H3.
What are the key properties of 2-(4-bromophenyl)-3,4-dimethylfuran?
2-(4-bromophenyl)-3,4-dimethylfuran has a molecular weight of 251.12 g/mol, XLogP of 4.33, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromophenyl)-3,4-dimethylfuran is sourced from PubChem (CID 132507630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).