C28H35N9O8 — CID 132507781
(2S,5S)-2-amino-5-[[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(6-benzamidopurin-9-yl)oxolan-2-yl]methyl]-6-(diaminomethylideneamino)hexanoic acid (PubChem CID 132507781) has the molecular formula C28H35N9O8 and a molecular weight of 625.64 g/mol. Its IUPAC name is (2S,5S)-2-amino-5-[[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(6-benzamidopurin-9-yl)oxolan-2-yl]methyl]-6-(diaminomethylideneamino)hexanoic acid.
| Compound Name | (2S,5S)-2-amino-5-[[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(6-benzamidopurin-9-yl)oxolan-2-yl]methyl]-6-(diaminomethylideneamino)hexanoic acid |
|---|---|
| PubChem CID | 132507781 |
| Molecular Formula | C28H35N9O8 |
| Molecular Weight | 625.64 g/mol |
| Exact Mass | 625.26 |
| IUPAC Name | (2S,5S)-2-amino-5-[[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(6-benzamidopurin-9-yl)oxolan-2-yl]methyl]-6-(diaminomethylideneamino)hexanoic acid |
| SMILES | CC(=O)O[C@@H]1[C@H](OC(C)=O)[C@@H](C[C@H](CC[C@H](N)C(=O)O)CN=C(N)N)O[C@H]1n1cnc2c(NC(=O)c3ccccc3)ncnc21 |
| InChI | InChI=1S/C28H35N9O8/c1-14(38)43-21-19(10-16(11-32-28(30)31)8-9-18(29)27(41)42)45-26(22(21)44-15(2)39)37-13-35-20-23(33-12-34-24(20)37)36-25(40)17-6-4-3-5-7-17/h3-7,12-13,16,18-19,21-22,26H,8-11,29H2,1-2H3,(H,41,42)(H4,30,31,32)(H,33,34,36,40)/t16-,18-,19+,21+,22+,26+/m0/s1 |
| InChIKey | PIPIGVDBQNOVRQ-AJMRDRLISA-N |
| XLogP | 0.31 |
| TPSA | 262.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.64 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|