C48H53N3O2S — CID 132508131
4-[7-[2-(5,10,10-trihexylindeno[1,2-b]indol-7-yl)ethynyl]-2,1,3-benzothiadiazol-4-yl]benzoic acid (PubChem CID 132508131) has the molecular formula C48H53N3O2S and a molecular weight of 736.04 g/mol. Its IUPAC name is 4-[7-[2-(5,10,10-trihexylindeno[1,2-b]indol-7-yl)ethynyl]-2,1,3-benzothiadiazol-4-yl]benzoic acid.
| Compound Name | 4-[7-[2-(5,10,10-trihexylindeno[1,2-b]indol-7-yl)ethynyl]-2,1,3-benzothiadiazol-4-yl]benzoic acid |
|---|---|
| PubChem CID | 132508131 |
| Molecular Formula | C48H53N3O2S |
| Molecular Weight | 736.04 g/mol |
| Exact Mass | 735.39 |
| IUPAC Name | 4-[7-[2-(5,10,10-trihexylindeno[1,2-b]indol-7-yl)ethynyl]-2,1,3-benzothiadiazol-4-yl]benzoic acid |
| SMILES | CCCCCCn1c2c(c3ccc(C#Cc4ccc(-c5ccc(C(=O)O)cc5)c5nsnc45)cc31)C(CCCCCC)(CCCCCC)c1ccccc1-2 |
| InChI | InChI=1S/C48H53N3O2S/c1-4-7-10-15-30-48(31-16-11-8-5-2)41-19-14-13-18-39(41)46-43(48)40-28-21-34(33-42(40)51(46)32-17-12-9-6-3)20-22-36-27-29-38(45-44(36)49-54-50-45)35-23-25-37(26-24-35)47(52)53/h13-14,18-19,21,23-29,33H,4-12,15-17,30-32H2,1-3H3,(H,52,53) |
| InChIKey | DEDLPMVFHOSVTK-UHFFFAOYSA-N |
| XLogP | 13.20 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.04 |
| LogP ≤ 5 | 13.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|