C26H20N2O2 — CID 132509014
6,19-dimethoxypentacyclo[12.8.0.02,11.03,8.017,22]docosa-1,3(8),4,6,11,13,17(22),18,20-nonaene-12,13-dicarbonitrile (PubChem CID 132509014) has the molecular formula C26H20N2O2 and a molecular weight of 392.46 g/mol. Its IUPAC name is 6,19-dimethoxypentacyclo[12.8.0.02,11.03,8.017,22]docosa-1,3(8),4,6,11,13,17(22),18,20-nonaene-12,13-dicarbonitrile.
| Compound Name | 6,19-dimethoxypentacyclo[12.8.0.02,11.03,8.017,22]docosa-1,3(8),4,6,11,13,17(22),18,20-nonaene-12,13-dicarbonitrile |
|---|---|
| PubChem CID | 132509014 |
| Molecular Formula | C26H20N2O2 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 6,19-dimethoxypentacyclo[12.8.0.02,11.03,8.017,22]docosa-1,3(8),4,6,11,13,17(22),18,20-nonaene-12,13-dicarbonitrile |
| SMILES | COc1ccc2c(c1)CCc1c(C#N)c(C#N)c3c(c1-2)-c1ccc(OC)cc1CC3 |
| InChI | InChI=1S/C26H20N2O2/c1-29-17-5-9-19-15(11-17)3-7-21-23(13-27)24(14-28)22-8-4-16-12-18(30-2)6-10-20(16)26(22)25(19)21/h5-6,9-12H,3-4,7-8H2,1-2H3 |
| InChIKey | JSNKUULBNPMXAM-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |