C60H60N4 — CID 132509532
3,6-ditert-butyl-9-[8-(3,6-ditert-butylcarbazol-9-yl)-2,3-diphenylquinoxalin-5-yl]carbazole (PubChem CID 132509532) has the molecular formula C60H60N4 and a molecular weight of 837.17 g/mol. Its IUPAC name is 3,6-ditert-butyl-9-[8-(3,6-ditert-butylcarbazol-9-yl)-2,3-diphenylquinoxalin-5-yl]carbazole.
| Compound Name | 3,6-ditert-butyl-9-[8-(3,6-ditert-butylcarbazol-9-yl)-2,3-diphenylquinoxalin-5-yl]carbazole |
|---|---|
| PubChem CID | 132509532 |
| Molecular Formula | C60H60N4 |
| Molecular Weight | 837.17 g/mol |
| Exact Mass | 836.48 |
| IUPAC Name | 3,6-ditert-butyl-9-[8-(3,6-ditert-butylcarbazol-9-yl)-2,3-diphenylquinoxalin-5-yl]carbazole |
| SMILES | CC(C)(C)c1ccc2c(c1)c1cc(C(C)(C)C)ccc1n2-c1ccc(-n2c3ccc(C(C)(C)C)cc3c3cc(C(C)(C)C)ccc32)c2nc(-c3ccccc3)c(-c3ccccc3)nc12 |
| InChI | InChI=1S/C60H60N4/c1-57(2,3)39-23-27-47-43(33-39)44-34-40(58(4,5)6)24-28-48(44)63(47)51-31-32-52(56-55(51)61-53(37-19-15-13-16-20-37)54(62-56)38-21-17-14-18-22-38)64-49-29-25-41(59(7,8)9)35-45(49)46-36-42(60(10,11)12)26-30-50(46)64/h13-36H,1-12H3 |
| InChIKey | PTKASDWDCSMGTQ-UHFFFAOYSA-N |
| XLogP | 16.35 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 837.17 |
| LogP ≤ 5 | 16.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |