C50H48N4O10S2 — CID 132509840
diethyl 3,4-bis[[2-(2-amino-3-cyano-7,7-dimethyl-5-oxo-6,8-dihydro-4H-chromen-4-yl)phenoxy]methyl]thieno[2,3-b]thiophene-2,5-dicarboxylate (PubChem CID 132509840) has the molecular formula C50H48N4O10S2 and a molecular weight of 929.09 g/mol. Its IUPAC name is diethyl 3,4-bis[[2-(2-amino-3-cyano-7,7-dimethyl-5-oxo-6,8-dihydro-4H-chromen-4-yl)phenoxy]methyl]thieno[2,3-b]thiophene-2,5-dicarboxylate.
| Compound Name | diethyl 3,4-bis[[2-(2-amino-3-cyano-7,7-dimethyl-5-oxo-6,8-dihydro-4H-chromen-4-yl)phenoxy]methyl]thieno[2,3-b]thiophene-2,5-dicarboxylate |
|---|---|
| PubChem CID | 132509840 |
| Molecular Formula | C50H48N4O10S2 |
| Molecular Weight | 929.09 g/mol |
| Exact Mass | 928.28 |
| IUPAC Name | diethyl 3,4-bis[[2-(2-amino-3-cyano-7,7-dimethyl-5-oxo-6,8-dihydro-4H-chromen-4-yl)phenoxy]methyl]thieno[2,3-b]thiophene-2,5-dicarboxylate |
| SMILES | CCOC(=O)c1sc2sc(C(=O)OCC)c(COc3ccccc3C3C(C#N)=C(N)OC4=C3C(=O)CC(C)(C)C4)c2c1COc1ccccc1C1C(C#N)=C(N)OC2=C1C(=O)CC(C)(C)C2 |
| InChI | InChI=1S/C50H48N4O10S2/c1-7-59-46(57)42-29(23-61-33-15-11-9-13-25(33)37-27(21-51)44(53)63-35-19-49(3,4)17-31(55)40(35)37)39-30(43(47(58)60-8-2)66-48(39)65-42)24-62-34-16-12-10-14-26(34)38-28(22-52)45(54)64-36-20-50(5,6)18-32(56)41(36)38/h9-16,37-38H,7-8,17-20,23-24,53-54H2,1-6H3 |
| InChIKey | MSFHKQDQMCEKRY-UHFFFAOYSA-N |
| XLogP | 9.38 |
| TPSA | 223.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 929.09 |
| LogP ≤ 5 | 9.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |