About (E)-1,12-dimethoxydodec-7-en-6-one
(E)-1,12-dimethoxydodec-7-en-6-one (PubChem CID 132509895) has the molecular formula C14H26O3
and a molecular weight of 242.36 g/mol. Its IUPAC name is (E)-1,12-dimethoxydodec-7-en-6-one.
Molecular Properties
| Compound Name | (E)-1,12-dimethoxydodec-7-en-6-one |
| PubChem CID | 132509895 |
| Molecular Formula | C14H26O3 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.19 |
| IUPAC Name | (E)-1,12-dimethoxydodec-7-en-6-one |
| SMILES | COCCCC/C=C/C(=O)CCCCCOC |
| InChI | InChI=1S/C14H26O3/c1-16-12-8-4-3-6-10-14(15)11-7-5-9-13-17-2/h6,10H,3-5,7-9,11-13H2,1-2H3/b10-6+ |
| InChIKey | JZIXKUOASVEJPY-UXBLZVDNSA-N |
| XLogP | 3.14 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-1,12-dimethoxydodec-7-en-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1,12-dimethoxydodec-7-en-6-one?
The IUPAC name of (E)-1,12-dimethoxydodec-7-en-6-one (CID 132509895) is (E)-1,12-dimethoxydodec-7-en-6-one.
What is the SMILES notation for (E)-1,12-dimethoxydodec-7-en-6-one?
The canonical SMILES for (E)-1,12-dimethoxydodec-7-en-6-one is COCCCC/C=C/C(=O)CCCCCOC.
What is the InChIKey of (E)-1,12-dimethoxydodec-7-en-6-one?
The InChIKey is JZIXKUOASVEJPY-UXBLZVDNSA-N. The full InChI is InChI=1S/C14H26O3/c1-16-12-8-4-3-6-10-14(15)11-7-5-9-13-17-2/h6,10H,3-5,7-9,11-13H2,1-2H3/b10-6+.
What are the key properties of (E)-1,12-dimethoxydodec-7-en-6-one?
(E)-1,12-dimethoxydodec-7-en-6-one has a molecular weight of 242.36 g/mol, XLogP of 3.14, 12 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1,12-dimethoxydodec-7-en-6-one is sourced from PubChem (CID 132509895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).