About 6-bromo-2-(4-hydroxyphenyl)chromenylium-5,7-diol
6-bromo-2-(4-hydroxyphenyl)chromenylium-5,7-diol (PubChem CID 132510671) has the molecular formula C15H10BrO4+
and a molecular weight of 334.15 g/mol. Its IUPAC name is 6-bromo-2-(4-hydroxyphenyl)chromenylium-5,7-diol.
Molecular Properties
| Compound Name | 6-bromo-2-(4-hydroxyphenyl)chromenylium-5,7-diol |
| PubChem CID | 132510671 |
| Molecular Formula | C15H10BrO4+ |
| Molecular Weight | 334.15 g/mol |
| Exact Mass | 332.98 |
| IUPAC Name | 6-bromo-2-(4-hydroxyphenyl)chromenylium-5,7-diol |
| SMILES | Oc1ccc(-c2ccc3c(O)c(Br)c(O)cc3[o+]2)cc1 |
| InChI | InChI=1S/C15H9BrO4/c16-14-11(18)7-13-10(15(14)19)5-6-12(20-13)8-1-3-9(17)4-2-8/h1-7H,(H2-,17,18,19)/p+1 |
| InChIKey | KMLJRXMPTNDLBG-UHFFFAOYSA-O |
| XLogP | 4.26 |
| TPSA | 71.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.15 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-2-(4-hydroxyphenyl)chromenylium-5,7-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-2-(4-hydroxyphenyl)chromenylium-5,7-diol?
The IUPAC name of 6-bromo-2-(4-hydroxyphenyl)chromenylium-5,7-diol (CID 132510671) is 6-bromo-2-(4-hydroxyphenyl)chromenylium-5,7-diol.
What is the SMILES notation for 6-bromo-2-(4-hydroxyphenyl)chromenylium-5,7-diol?
The canonical SMILES for 6-bromo-2-(4-hydroxyphenyl)chromenylium-5,7-diol is Oc1ccc(-c2ccc3c(O)c(Br)c(O)cc3[o+]2)cc1.
What is the InChIKey of 6-bromo-2-(4-hydroxyphenyl)chromenylium-5,7-diol?
The InChIKey is KMLJRXMPTNDLBG-UHFFFAOYSA-O. The full InChI is InChI=1S/C15H9BrO4/c16-14-11(18)7-13-10(15(14)19)5-6-12(20-13)8-1-3-9(17)4-2-8/h1-7H,(H2-,17,18,19)/p+1.
What are the key properties of 6-bromo-2-(4-hydroxyphenyl)chromenylium-5,7-diol?
6-bromo-2-(4-hydroxyphenyl)chromenylium-5,7-diol has a molecular weight of 334.15 g/mol, XLogP of 4.26, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-2-(4-hydroxyphenyl)chromenylium-5,7-diol is sourced from PubChem (CID 132510671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).