About 4-(6-chlorohexyl)-2,3,5,6-tetrafluoropyridine
4-(6-chlorohexyl)-2,3,5,6-tetrafluoropyridine (PubChem CID 132510764) has the molecular formula C11H12ClF4N
and a molecular weight of 269.67 g/mol. Its IUPAC name is 4-(6-chlorohexyl)-2,3,5,6-tetrafluoropyridine.
Molecular Properties
| Compound Name | 4-(6-chlorohexyl)-2,3,5,6-tetrafluoropyridine |
| PubChem CID | 132510764 |
| Molecular Formula | C11H12ClF4N |
| Molecular Weight | 269.67 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | 4-(6-chlorohexyl)-2,3,5,6-tetrafluoropyridine |
| SMILES | Fc1nc(F)c(F)c(CCCCCCCl)c1F |
| InChI | InChI=1S/C11H12ClF4N/c12-6-4-2-1-3-5-7-8(13)10(15)17-11(16)9(7)14/h1-6H2 |
| InChIKey | IMKBKKBPJCQHCI-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.67 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(6-chlorohexyl)-2,3,5,6-tetrafluoropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(6-chlorohexyl)-2,3,5,6-tetrafluoropyridine?
The IUPAC name of 4-(6-chlorohexyl)-2,3,5,6-tetrafluoropyridine (CID 132510764) is 4-(6-chlorohexyl)-2,3,5,6-tetrafluoropyridine.
What is the SMILES notation for 4-(6-chlorohexyl)-2,3,5,6-tetrafluoropyridine?
The canonical SMILES for 4-(6-chlorohexyl)-2,3,5,6-tetrafluoropyridine is Fc1nc(F)c(F)c(CCCCCCCl)c1F.
What is the InChIKey of 4-(6-chlorohexyl)-2,3,5,6-tetrafluoropyridine?
The InChIKey is IMKBKKBPJCQHCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12ClF4N/c12-6-4-2-1-3-5-7-8(13)10(15)17-11(16)9(7)14/h1-6H2.
What are the key properties of 4-(6-chlorohexyl)-2,3,5,6-tetrafluoropyridine?
4-(6-chlorohexyl)-2,3,5,6-tetrafluoropyridine has a molecular weight of 269.67 g/mol, XLogP of 3.98, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(6-chlorohexyl)-2,3,5,6-tetrafluoropyridine is sourced from PubChem (CID 132510764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).