About 1-(5-bromo-1-butylindol-3-yl)-N,N-dimethylmethanamine
1-(5-bromo-1-butylindol-3-yl)-N,N-dimethylmethanamine (PubChem CID 132510885) has the molecular formula C15H21BrN2
and a molecular weight of 309.25 g/mol. Its IUPAC name is 1-(5-bromo-1-butylindol-3-yl)-N,N-dimethylmethanamine.
Molecular Properties
| Compound Name | 1-(5-bromo-1-butylindol-3-yl)-N,N-dimethylmethanamine |
| PubChem CID | 132510885 |
| Molecular Formula | C15H21BrN2 |
| Molecular Weight | 309.25 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 1-(5-bromo-1-butylindol-3-yl)-N,N-dimethylmethanamine |
| SMILES | CCCCn1cc(CN(C)C)c2cc(Br)ccc21 |
| InChI | InChI=1S/C15H21BrN2/c1-4-5-8-18-11-12(10-17(2)3)14-9-13(16)6-7-15(14)18/h6-7,9,11H,4-5,8,10H2,1-3H3 |
| InChIKey | QRAWZHRXCWVDNZ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.25 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(5-bromo-1-butylindol-3-yl)-N,N-dimethylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-bromo-1-butylindol-3-yl)-N,N-dimethylmethanamine?
The IUPAC name of 1-(5-bromo-1-butylindol-3-yl)-N,N-dimethylmethanamine (CID 132510885) is 1-(5-bromo-1-butylindol-3-yl)-N,N-dimethylmethanamine.
What is the SMILES notation for 1-(5-bromo-1-butylindol-3-yl)-N,N-dimethylmethanamine?
The canonical SMILES for 1-(5-bromo-1-butylindol-3-yl)-N,N-dimethylmethanamine is CCCCn1cc(CN(C)C)c2cc(Br)ccc21.
What is the InChIKey of 1-(5-bromo-1-butylindol-3-yl)-N,N-dimethylmethanamine?
The InChIKey is QRAWZHRXCWVDNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21BrN2/c1-4-5-8-18-11-12(10-17(2)3)14-9-13(16)6-7-15(14)18/h6-7,9,11H,4-5,8,10H2,1-3H3.
What are the key properties of 1-(5-bromo-1-butylindol-3-yl)-N,N-dimethylmethanamine?
1-(5-bromo-1-butylindol-3-yl)-N,N-dimethylmethanamine has a molecular weight of 309.25 g/mol, XLogP of 4.27, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-bromo-1-butylindol-3-yl)-N,N-dimethylmethanamine is sourced from PubChem (CID 132510885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).