About methyl (E)-3-(4-methoxyphenyl)-2-(pentafluoro-λ6-sulfanyl)prop-2-enoate
methyl (E)-3-(4-methoxyphenyl)-2-(pentafluoro-λ6-sulfanyl)prop-2-enoate (PubChem CID 132510965) has the molecular formula C11H11F5O3S
and a molecular weight of 318.26 g/mol. Its IUPAC name is methyl (E)-3-(4-methoxyphenyl)-2-(pentafluoro-λ6-sulfanyl)prop-2-enoate.
Molecular Properties
| Compound Name | methyl (E)-3-(4-methoxyphenyl)-2-(pentafluoro-λ6-sulfanyl)prop-2-enoate |
| PubChem CID | 132510965 |
| Molecular Formula | C11H11F5O3S |
| Molecular Weight | 318.26 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | methyl (E)-3-(4-methoxyphenyl)-2-(pentafluoro-λ6-sulfanyl)prop-2-enoate |
| SMILES | COC(=O)/C(=C\c1ccc(OC)cc1)S(F)(F)(F)(F)F |
| InChI | InChI=1S/C11H11F5O3S/c1-18-9-5-3-8(4-6-9)7-10(11(17)19-2)20(12,13,14,15)16/h3-7H,1-2H3/b10-7+ |
| InChIKey | VUTNGOLFMGSBBA-JXMROGBWSA-N |
| XLogP | 4.51 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.26 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl (E)-3-(4-methoxyphenyl)-2-(pentafluoro-λ6-sulfanyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (E)-3-(4-methoxyphenyl)-2-(pentafluoro-λ6-sulfanyl)prop-2-enoate?
The IUPAC name of methyl (E)-3-(4-methoxyphenyl)-2-(pentafluoro-λ6-sulfanyl)prop-2-enoate (CID 132510965) is methyl (E)-3-(4-methoxyphenyl)-2-(pentafluoro-λ6-sulfanyl)prop-2-enoate.
What is the SMILES notation for methyl (E)-3-(4-methoxyphenyl)-2-(pentafluoro-λ6-sulfanyl)prop-2-enoate?
The canonical SMILES for methyl (E)-3-(4-methoxyphenyl)-2-(pentafluoro-λ6-sulfanyl)prop-2-enoate is COC(=O)/C(=C\c1ccc(OC)cc1)S(F)(F)(F)(F)F.
What is the InChIKey of methyl (E)-3-(4-methoxyphenyl)-2-(pentafluoro-λ6-sulfanyl)prop-2-enoate?
The InChIKey is VUTNGOLFMGSBBA-JXMROGBWSA-N. The full InChI is InChI=1S/C11H11F5O3S/c1-18-9-5-3-8(4-6-9)7-10(11(17)19-2)20(12,13,14,15)16/h3-7H,1-2H3/b10-7+.
What are the key properties of methyl (E)-3-(4-methoxyphenyl)-2-(pentafluoro-λ6-sulfanyl)prop-2-enoate?
methyl (E)-3-(4-methoxyphenyl)-2-(pentafluoro-λ6-sulfanyl)prop-2-enoate has a molecular weight of 318.26 g/mol, XLogP of 4.51, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (E)-3-(4-methoxyphenyl)-2-(pentafluoro-λ6-sulfanyl)prop-2-enoate is sourced from PubChem (CID 132510965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).