About 5-bromo-1'-phenylspiro[3H-indene-2,3'-pyrrolidine]-1,2'-dione
5-bromo-1'-phenylspiro[3H-indene-2,3'-pyrrolidine]-1,2'-dione (PubChem CID 132511016) has the molecular formula C18H14BrNO2
and a molecular weight of 356.22 g/mol. Its IUPAC name is 5-bromo-1'-phenylspiro[3H-indene-2,3'-pyrrolidine]-1,2'-dione.
Molecular Properties
| Compound Name | 5-bromo-1'-phenylspiro[3H-indene-2,3'-pyrrolidine]-1,2'-dione |
| PubChem CID | 132511016 |
| Molecular Formula | C18H14BrNO2 |
| Molecular Weight | 356.22 g/mol |
| Exact Mass | 355.02 |
| IUPAC Name | 5-bromo-1'-phenylspiro[3H-indene-2,3'-pyrrolidine]-1,2'-dione |
| SMILES | O=C1c2ccc(Br)cc2CC12CCN(c1ccccc1)C2=O |
| InChI | InChI=1S/C18H14BrNO2/c19-13-6-7-15-12(10-13)11-18(16(15)21)8-9-20(17(18)22)14-4-2-1-3-5-14/h1-7,10H,8-9,11H2 |
| InChIKey | SSAHSQWTSBHHFH-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.22 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-1'-phenylspiro[3H-indene-2,3'-pyrrolidine]-1,2'-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-1'-phenylspiro[3H-indene-2,3'-pyrrolidine]-1,2'-dione?
The IUPAC name of 5-bromo-1'-phenylspiro[3H-indene-2,3'-pyrrolidine]-1,2'-dione (CID 132511016) is 5-bromo-1'-phenylspiro[3H-indene-2,3'-pyrrolidine]-1,2'-dione.
What is the SMILES notation for 5-bromo-1'-phenylspiro[3H-indene-2,3'-pyrrolidine]-1,2'-dione?
The canonical SMILES for 5-bromo-1'-phenylspiro[3H-indene-2,3'-pyrrolidine]-1,2'-dione is O=C1c2ccc(Br)cc2CC12CCN(c1ccccc1)C2=O.
What is the InChIKey of 5-bromo-1'-phenylspiro[3H-indene-2,3'-pyrrolidine]-1,2'-dione?
The InChIKey is SSAHSQWTSBHHFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14BrNO2/c19-13-6-7-15-12(10-13)11-18(16(15)21)8-9-20(17(18)22)14-4-2-1-3-5-14/h1-7,10H,8-9,11H2.
What are the key properties of 5-bromo-1'-phenylspiro[3H-indene-2,3'-pyrrolidine]-1,2'-dione?
5-bromo-1'-phenylspiro[3H-indene-2,3'-pyrrolidine]-1,2'-dione has a molecular weight of 356.22 g/mol, XLogP of 3.61, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-1'-phenylspiro[3H-indene-2,3'-pyrrolidine]-1,2'-dione is sourced from PubChem (CID 132511016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).