C74H96N8 — CID 132511205
3,4-diethyl-1-[1,3,4,5,6,7,8-heptakis(3,4-diethylpyrrol-1-yl)naphthalen-2-yl]pyrrole (PubChem CID 132511205) has the molecular formula C74H96N8 and a molecular weight of 1097.64 g/mol. Its IUPAC name is 3,4-diethyl-1-[1,3,4,5,6,7,8-heptakis(3,4-diethylpyrrol-1-yl)naphthalen-2-yl]pyrrole.
| Compound Name | 3,4-diethyl-1-[1,3,4,5,6,7,8-heptakis(3,4-diethylpyrrol-1-yl)naphthalen-2-yl]pyrrole |
|---|---|
| PubChem CID | 132511205 |
| Molecular Formula | C74H96N8 |
| Molecular Weight | 1097.64 g/mol |
| Exact Mass | 1096.78 |
| IUPAC Name | 3,4-diethyl-1-[1,3,4,5,6,7,8-heptakis(3,4-diethylpyrrol-1-yl)naphthalen-2-yl]pyrrole |
| SMILES | CCc1cn(-c2c(-n3cc(CC)c(CC)c3)c(-n3cc(CC)c(CC)c3)c3c(-n4cc(CC)c(CC)c4)c(-n4cc(CC)c(CC)c4)c(-n4cc(CC)c(CC)c4)c(-n4cc(CC)c(CC)c4)c3c2-n2cc(CC)c(CC)c2)cc1CC |
| InChI | InChI=1S/C74H96N8/c1-17-49-33-75(34-50(49)18-2)67-65-66(69(77-37-53(21-5)54(22-6)38-77)72(80-43-59(27-11)60(28-12)44-80)71(67)79-41-57(25-9)58(26-10)42-79)70(78-39-55(23-7)56(24-8)40-78)74(82-47-63(31-15)64(32-16)48-82)73(81-45-61(29-13)62(30-14)46-81)68(65)76-35-51(19-3)52(20-4)36-76/h33-48H,17-32H2,1-16H3 |
| InChIKey | ZBNCKDIXDQXOOZ-UHFFFAOYSA-N |
| XLogP | 18.16 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 82 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1097.64 |
| LogP ≤ 5 | 18.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |