C49H44BNOS2 — CID 132511295
4-[2-bis(2,4,6-trimethylphenyl)boranyl-6-(4-methoxyphenyl)thieno[3,2-b]thiophen-5-yl]-N,N-diphenylaniline (PubChem CID 132511295) has the molecular formula C49H44BNOS2 and a molecular weight of 737.84 g/mol. Its IUPAC name is 4-[2-bis(2,4,6-trimethylphenyl)boranyl-6-(4-methoxyphenyl)thieno[3,2-b]thiophen-5-yl]-N,N-diphenylaniline.
| Compound Name | 4-[2-bis(2,4,6-trimethylphenyl)boranyl-6-(4-methoxyphenyl)thieno[3,2-b]thiophen-5-yl]-N,N-diphenylaniline |
|---|---|
| PubChem CID | 132511295 |
| Molecular Formula | C49H44BNOS2 |
| Molecular Weight | 737.84 g/mol |
| Exact Mass | 737.30 |
| IUPAC Name | 4-[2-bis(2,4,6-trimethylphenyl)boranyl-6-(4-methoxyphenyl)thieno[3,2-b]thiophen-5-yl]-N,N-diphenylaniline |
| SMILES | COc1ccc(-c2c(-c3ccc(N(c4ccccc4)c4ccccc4)cc3)sc3cc(B(c4c(C)cc(C)cc4C)c4c(C)cc(C)cc4C)sc23)cc1 |
| InChI | InChI=1S/C49H44BNOS2/c1-31-26-33(3)46(34(4)27-31)50(47-35(5)28-32(2)29-36(47)6)44-30-43-49(54-44)45(37-20-24-42(52-7)25-21-37)48(53-43)38-18-22-41(23-19-38)51(39-14-10-8-11-15-39)40-16-12-9-13-17-40/h8-30H,1-7H3 |
| InChIKey | YVIGPSBJDCOUPO-UHFFFAOYSA-N |
| XLogP | 12.14 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.84 |
| LogP ≤ 5 | 12.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|