C20H20N2O2 — CID 132512074
butyl (E)-3-(2-pyrrolo[2,3-b]pyridin-1-ylphenyl)prop-2-enoate (PubChem CID 132512074) has the molecular formula C20H20N2O2 and a molecular weight of 320.39 g/mol. Its IUPAC name is butyl (E)-3-(2-pyrrolo[2,3-b]pyridin-1-ylphenyl)prop-2-enoate.
| Compound Name | butyl (E)-3-(2-pyrrolo[2,3-b]pyridin-1-ylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 132512074 |
| Molecular Formula | C20H20N2O2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | butyl (E)-3-(2-pyrrolo[2,3-b]pyridin-1-ylphenyl)prop-2-enoate |
| SMILES | CCCCOC(=O)/C=C/c1ccccc1-n1ccc2cccnc21 |
| InChI | InChI=1S/C20H20N2O2/c1-2-3-15-24-19(23)11-10-16-7-4-5-9-18(16)22-14-12-17-8-6-13-21-20(17)22/h4-14H,2-3,15H2,1H3/b11-10+ |
| InChIKey | XNFRRITVJKBJBH-ZHACJKMWSA-N |
| XLogP | 4.38 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|