C14H18O4 — CID 132512192
(2R,4R)-2,4,6-trihydroxy-3,3,4,7-tetramethyl-2H-naphthalen-1-one (PubChem CID 132512192) has the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. Its IUPAC name is (2R,4R)-2,4,6-trihydroxy-3,3,4,7-tetramethyl-2H-naphthalen-1-one.
| Compound Name | (2R,4R)-2,4,6-trihydroxy-3,3,4,7-tetramethyl-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 132512192 |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | (2R,4R)-2,4,6-trihydroxy-3,3,4,7-tetramethyl-2H-naphthalen-1-one |
| SMILES | Cc1cc2c(cc1O)[C@@](C)(O)C(C)(C)[C@@H](O)C2=O |
| InChI | InChI=1S/C14H18O4/c1-7-5-8-9(6-10(7)15)14(4,18)13(2,3)12(17)11(8)16/h5-6,12,15,17-18H,1-4H3/t12-,14+/m0/s1 |
| InChIKey | YNEQZTAMTVWJKR-GXTWGEPZSA-N |
| XLogP | 1.49 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |