C27H20O8 — CID 132512212
(7S)-3,19,26-trihydroxy-15-methoxy-7-methyl-6-oxahexacyclo[12.12.0.02,11.04,9.016,25.018,23]hexacosa-1(14),2,4(9),10,15,18(23),19,21,25-nonaene-5,17,24-trione (PubChem CID 132512212) has the molecular formula C27H20O8 and a molecular weight of 472.45 g/mol. Its IUPAC name is (7S)-3,19,26-trihydroxy-15-methoxy-7-methyl-6-oxahexacyclo[12.12.0.02,11.04,9.016,25.018,23]hexacosa-1(14),2,4(9),10,15,18(23),19,21,25-nonaene-5,17,24-trione.
| Compound Name | (7S)-3,19,26-trihydroxy-15-methoxy-7-methyl-6-oxahexacyclo[12.12.0.02,11.04,9.016,25.018,23]hexacosa-1(14),2,4(9),10,15,18(23),19,21,25-nonaene-5,17,24-trione |
|---|---|
| PubChem CID | 132512212 |
| Molecular Formula | C27H20O8 |
| Molecular Weight | 472.45 g/mol |
| Exact Mass | 472.12 |
| IUPAC Name | (7S)-3,19,26-trihydroxy-15-methoxy-7-methyl-6-oxahexacyclo[12.12.0.02,11.04,9.016,25.018,23]hexacosa-1(14),2,4(9),10,15,18(23),19,21,25-nonaene-5,17,24-trione |
| SMILES | COc1c2c(c(O)c3c1C(=O)c1c(O)cccc1C3=O)-c1c(cc3c(c1O)C(=O)O[C@@H](C)C3)CC2 |
| InChI | InChI=1S/C27H20O8/c1-10-8-12-9-11-6-7-14-19(16(11)23(30)17(12)27(33)35-10)25(32)20-21(26(14)34-2)24(31)18-13(22(20)29)4-3-5-15(18)28/h3-5,9-10,28,30,32H,6-8H2,1-2H3/t10-/m0/s1 |
| InChIKey | VDBDMDLSSKXMLC-JTQLQIEISA-N |
| XLogP | 3.45 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.45 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|