C38H36N2O2S2Si2 — CID 132512908
2,5-dimethyl-1,4-bis[4-[5-(2-trimethylsilylethynyl)thiophen-2-yl]phenyl]pyrrolo[3,4-c]pyrrole-3,6-dione (PubChem CID 132512908) has the molecular formula C38H36N2O2S2Si2 and a molecular weight of 673.02 g/mol. Its IUPAC name is 2,5-dimethyl-1,4-bis[4-[5-(2-trimethylsilylethynyl)thiophen-2-yl]phenyl]pyrrolo[3,4-c]pyrrole-3,6-dione.
| Compound Name | 2,5-dimethyl-1,4-bis[4-[5-(2-trimethylsilylethynyl)thiophen-2-yl]phenyl]pyrrolo[3,4-c]pyrrole-3,6-dione |
|---|---|
| PubChem CID | 132512908 |
| Molecular Formula | C38H36N2O2S2Si2 |
| Molecular Weight | 673.02 g/mol |
| Exact Mass | 672.18 |
| IUPAC Name | 2,5-dimethyl-1,4-bis[4-[5-(2-trimethylsilylethynyl)thiophen-2-yl]phenyl]pyrrolo[3,4-c]pyrrole-3,6-dione |
| SMILES | CN1C(=O)C2=C(c3ccc(-c4ccc(C#C[Si](C)(C)C)s4)cc3)N(C)C(=O)C2=C1c1ccc(-c2ccc(C#C[Si](C)(C)C)s2)cc1 |
| InChI | InChI=1S/C38H36N2O2S2Si2/c1-39-35(27-13-9-25(10-14-27)31-19-17-29(43-31)21-23-45(3,4)5)33-34(37(39)41)36(40(2)38(33)42)28-15-11-26(12-16-28)32-20-18-30(44-32)22-24-46(6,7)8/h9-20H,1-8H3 |
| InChIKey | FIHRYTZJNKXNSI-UHFFFAOYSA-N |
| XLogP | 8.67 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.02 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|