C27H30Cl2N2O2 — CID 132513966
butyl 3,3-bis(5-chloro-1-ethylindol-3-yl)propanoate (PubChem CID 132513966) has the molecular formula C27H30Cl2N2O2 and a molecular weight of 485.46 g/mol. Its IUPAC name is butyl 3,3-bis(5-chloro-1-ethylindol-3-yl)propanoate.
| Compound Name | butyl 3,3-bis(5-chloro-1-ethylindol-3-yl)propanoate |
|---|---|
| PubChem CID | 132513966 |
| Molecular Formula | C27H30Cl2N2O2 |
| Molecular Weight | 485.46 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | butyl 3,3-bis(5-chloro-1-ethylindol-3-yl)propanoate |
| SMILES | CCCCOC(=O)CC(c1cn(CC)c2ccc(Cl)cc12)c1cn(CC)c2ccc(Cl)cc12 |
| InChI | InChI=1S/C27H30Cl2N2O2/c1-4-7-12-33-27(32)15-20(23-16-30(5-2)25-10-8-18(28)13-21(23)25)24-17-31(6-3)26-11-9-19(29)14-22(24)26/h8-11,13-14,16-17,20H,4-7,12,15H2,1-3H3 |
| InChIKey | CFMBGZPVOBCGJX-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 36.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.46 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|