C28H48O5 — CID 132514429
(2E,4R,5S,6E,8R,9R,10E,12R,13R,14E,16R,18R)-5,9,13-trihydroxy-16-(hydroxymethyl)-2,4,8,10,12,14,18-heptamethylicosa-2,6,10,14-tetraenal (PubChem CID 132514429) has the molecular formula C28H48O5 and a molecular weight of 464.69 g/mol. Its IUPAC name is (2E,4R,5S,6E,8R,9R,10E,12R,13R,14E,16R,18R)-5,9,13-trihydroxy-16-(hydroxymethyl)-2,4,8,10,12,14,18-heptamethylicosa-2,6,10,14-tetraenal.
| Compound Name | (2E,4R,5S,6E,8R,9R,10E,12R,13R,14E,16R,18R)-5,9,13-trihydroxy-16-(hydroxymethyl)-2,4,8,10,12,14,18-heptamethylicosa-2,6,10,14-tetraenal |
|---|---|
| PubChem CID | 132514429 |
| Molecular Formula | C28H48O5 |
| Molecular Weight | 464.69 g/mol |
| Exact Mass | 464.35 |
| IUPAC Name | (2E,4R,5S,6E,8R,9R,10E,12R,13R,14E,16R,18R)-5,9,13-trihydroxy-16-(hydroxymethyl)-2,4,8,10,12,14,18-heptamethylicosa-2,6,10,14-tetraenal |
| SMILES | CC[C@@H](C)C[C@H](/C=C(\C)[C@H](O)[C@H](C)/C=C(\C)[C@H](O)[C@H](C)/C=C/[C@H](O)[C@H](C)/C=C(\C)C=O)CO |
| InChI | InChI=1S/C28H48O5/c1-9-18(2)13-25(17-30)15-24(8)28(33)23(7)14-22(6)27(32)20(4)10-11-26(31)21(5)12-19(3)16-29/h10-12,14-16,18,20-21,23,25-28,30-33H,9,13,17H2,1-8H3/b11-10+,19-12+,22-14+,24-15+/t18-,20-,21-,23-,25-,26+,27-,28-/m1/s1 |
| InChIKey | NVPXIJZSAVUDBQ-LFHUWNPQSA-N |
| XLogP | 4.62 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.69 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|