C25H26N6O6S — CID 132514497
2-[6-[5-(1,4-diazabicyclo[3.2.2]nonan-4-yl)-1,3,4-oxadiazol-2-yl]indol-1-yl]ethyl 4-nitrobenzenesulfonate (PubChem CID 132514497) has the molecular formula C25H26N6O6S and a molecular weight of 538.59 g/mol. Its IUPAC name is 2-[6-[5-(1,4-diazabicyclo[3.2.2]nonan-4-yl)-1,3,4-oxadiazol-2-yl]indol-1-yl]ethyl 4-nitrobenzenesulfonate.
| Compound Name | 2-[6-[5-(1,4-diazabicyclo[3.2.2]nonan-4-yl)-1,3,4-oxadiazol-2-yl]indol-1-yl]ethyl 4-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 132514497 |
| Molecular Formula | C25H26N6O6S |
| Molecular Weight | 538.59 g/mol |
| Exact Mass | 538.16 |
| IUPAC Name | 2-[6-[5-(1,4-diazabicyclo[3.2.2]nonan-4-yl)-1,3,4-oxadiazol-2-yl]indol-1-yl]ethyl 4-nitrobenzenesulfonate |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)OCCn2ccc3ccc(-c4nnc(N5CCN6CCC5CC6)o4)cc32)cc1 |
| InChI | InChI=1S/C25H26N6O6S/c32-31(33)21-3-5-22(6-4-21)38(34,35)36-16-15-29-12-7-18-1-2-19(17-23(18)29)24-26-27-25(37-24)30-14-13-28-10-8-20(30)9-11-28/h1-7,12,17,20H,8-11,13-16H2 |
| InChIKey | WAHSJWTUYGEFLL-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 136.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.59 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|