About 2-[[benzyl-[[(2S)-1-butylpyrrolidin-2-yl]methyl]amino]methyl]-4,6-dichlorophenol
2-[[benzyl-[[(2S)-1-butylpyrrolidin-2-yl]methyl]amino]methyl]-4,6-dichlorophenol (PubChem CID 132515735) has the molecular formula C23H30Cl2N2O
and a molecular weight of 421.41 g/mol. Its IUPAC name is 2-[[benzyl-[[(2S)-1-butylpyrrolidin-2-yl]methyl]amino]methyl]-4,6-dichlorophenol.
Molecular Properties
| Compound Name | 2-[[benzyl-[[(2S)-1-butylpyrrolidin-2-yl]methyl]amino]methyl]-4,6-dichlorophenol |
| PubChem CID | 132515735 |
| Molecular Formula | C23H30Cl2N2O |
| Molecular Weight | 421.41 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | 2-[[benzyl-[[(2S)-1-butylpyrrolidin-2-yl]methyl]amino]methyl]-4,6-dichlorophenol |
| SMILES | CCCCN1CCC[C@H]1CN(Cc1ccccc1)Cc1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C23H30Cl2N2O/c1-2-3-11-27-12-7-10-21(27)17-26(15-18-8-5-4-6-9-18)16-19-13-20(24)14-22(25)23(19)28/h4-6,8-9,13-14,21,28H,2-3,7,10-12,15-17H2,1H3/t21-/m0/s1 |
| InChIKey | SSZADEOCFAWXNL-NRFANRHFSA-N |
| XLogP | 5.97 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 421.41 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 2-[[benzyl-[[(2S)-1-butylpyrrolidin-2-yl]methyl]amino]methyl]-4,6-dichlorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[benzyl-[[(2S)-1-butylpyrrolidin-2-yl]methyl]amino]methyl]-4,6-dichlorophenol?
The IUPAC name of 2-[[benzyl-[[(2S)-1-butylpyrrolidin-2-yl]methyl]amino]methyl]-4,6-dichlorophenol (CID 132515735) is 2-[[benzyl-[[(2S)-1-butylpyrrolidin-2-yl]methyl]amino]methyl]-4,6-dichlorophenol.
What is the SMILES notation for 2-[[benzyl-[[(2S)-1-butylpyrrolidin-2-yl]methyl]amino]methyl]-4,6-dichlorophenol?
The canonical SMILES for 2-[[benzyl-[[(2S)-1-butylpyrrolidin-2-yl]methyl]amino]methyl]-4,6-dichlorophenol is CCCCN1CCC[C@H]1CN(Cc1ccccc1)Cc1cc(Cl)cc(Cl)c1O.
What is the InChIKey of 2-[[benzyl-[[(2S)-1-butylpyrrolidin-2-yl]methyl]amino]methyl]-4,6-dichlorophenol?
The InChIKey is SSZADEOCFAWXNL-NRFANRHFSA-N. The full InChI is InChI=1S/C23H30Cl2N2O/c1-2-3-11-27-12-7-10-21(27)17-26(15-18-8-5-4-6-9-18)16-19-13-20(24)14-22(25)23(19)28/h4-6,8-9,13-14,21,28H,2-3,7,10-12,15-17H2,1H3/t21-/m0/s1.
What are the key properties of 2-[[benzyl-[[(2S)-1-butylpyrrolidin-2-yl]methyl]amino]methyl]-4,6-dichlorophenol?
2-[[benzyl-[[(2S)-1-butylpyrrolidin-2-yl]methyl]amino]methyl]-4,6-dichlorophenol has a molecular weight of 421.41 g/mol, XLogP of 5.97, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[benzyl-[[(2S)-1-butylpyrrolidin-2-yl]methyl]amino]methyl]-4,6-dichlorophenol is sourced from PubChem (CID 132515735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).