C46H52N4O4 — CID 132516807
2,5-bis(2-nitrophenyl)-1,4-bis(4-octylphenyl)pyrrolo[3,2-b]pyrrole (PubChem CID 132516807) has the molecular formula C46H52N4O4 and a molecular weight of 724.95 g/mol. Its IUPAC name is 2,5-bis(2-nitrophenyl)-1,4-bis(4-octylphenyl)pyrrolo[3,2-b]pyrrole.
| Compound Name | 2,5-bis(2-nitrophenyl)-1,4-bis(4-octylphenyl)pyrrolo[3,2-b]pyrrole |
|---|---|
| PubChem CID | 132516807 |
| Molecular Formula | C46H52N4O4 |
| Molecular Weight | 724.95 g/mol |
| Exact Mass | 724.40 |
| IUPAC Name | 2,5-bis(2-nitrophenyl)-1,4-bis(4-octylphenyl)pyrrolo[3,2-b]pyrrole |
| SMILES | CCCCCCCCc1ccc(-n2c(-c3ccccc3[N+](=O)[O-])cc3c2cc(-c2ccccc2[N+](=O)[O-])n3-c2ccc(CCCCCCCC)cc2)cc1 |
| InChI | InChI=1S/C46H52N4O4/c1-3-5-7-9-11-13-19-35-25-29-37(30-26-35)47-43(39-21-15-17-23-41(39)49(51)52)33-46-45(47)34-44(40-22-16-18-24-42(40)50(53)54)48(46)38-31-27-36(28-32-38)20-14-12-10-8-6-4-2/h15-18,21-34H,3-14,19-20H2,1-2H3 |
| InChIKey | WFFNNSAVIMBMNK-UHFFFAOYSA-N |
| XLogP | 13.38 |
| TPSA | 96.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.95 |
| LogP ≤ 5 | 13.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|