About 4-[(2S)-2-(hydroxymethyl)-1,4-dioxan-2-yl]butan-1-ol
4-[(2S)-2-(hydroxymethyl)-1,4-dioxan-2-yl]butan-1-ol (PubChem CID 132517063) has the molecular formula C9H18O4
and a molecular weight of 190.24 g/mol. Its IUPAC name is 4-[(2S)-2-(hydroxymethyl)-1,4-dioxan-2-yl]butan-1-ol.
Molecular Properties
| Compound Name | 4-[(2S)-2-(hydroxymethyl)-1,4-dioxan-2-yl]butan-1-ol |
| PubChem CID | 132517063 |
| Molecular Formula | C9H18O4 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 4-[(2S)-2-(hydroxymethyl)-1,4-dioxan-2-yl]butan-1-ol |
| SMILES | OCCCC[C@]1(CO)COCCO1 |
| InChI | InChI=1S/C9H18O4/c10-4-2-1-3-9(7-11)8-12-5-6-13-9/h10-11H,1-8H2/t9-/m0/s1 |
| InChIKey | BBUNMAQKQHGYFF-VIFPVBQESA-N |
| XLogP | -0.07 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2S)-2-(hydroxymethyl)-1,4-dioxan-2-yl]butan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2S)-2-(hydroxymethyl)-1,4-dioxan-2-yl]butan-1-ol?
The IUPAC name of 4-[(2S)-2-(hydroxymethyl)-1,4-dioxan-2-yl]butan-1-ol (CID 132517063) is 4-[(2S)-2-(hydroxymethyl)-1,4-dioxan-2-yl]butan-1-ol.
What is the SMILES notation for 4-[(2S)-2-(hydroxymethyl)-1,4-dioxan-2-yl]butan-1-ol?
The canonical SMILES for 4-[(2S)-2-(hydroxymethyl)-1,4-dioxan-2-yl]butan-1-ol is OCCCC[C@]1(CO)COCCO1.
What is the InChIKey of 4-[(2S)-2-(hydroxymethyl)-1,4-dioxan-2-yl]butan-1-ol?
The InChIKey is BBUNMAQKQHGYFF-VIFPVBQESA-N. The full InChI is InChI=1S/C9H18O4/c10-4-2-1-3-9(7-11)8-12-5-6-13-9/h10-11H,1-8H2/t9-/m0/s1.
What are the key properties of 4-[(2S)-2-(hydroxymethyl)-1,4-dioxan-2-yl]butan-1-ol?
4-[(2S)-2-(hydroxymethyl)-1,4-dioxan-2-yl]butan-1-ol has a molecular weight of 190.24 g/mol, XLogP of -0.07, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2S)-2-(hydroxymethyl)-1,4-dioxan-2-yl]butan-1-ol is sourced from PubChem (CID 132517063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).