C17H28OS — CID 132517231
S-ethyl (1R,2S,8aR)-1,2,5,5-tetramethyl-2,3,6,7,8,8a-hexahydronaphthalene-1-carbothioate (PubChem CID 132517231) has the molecular formula C17H28OS and a molecular weight of 280.48 g/mol. Its IUPAC name is S-ethyl (1R,2S,8aR)-1,2,5,5-tetramethyl-2,3,6,7,8,8a-hexahydronaphthalene-1-carbothioate.
| Compound Name | S-ethyl (1R,2S,8aR)-1,2,5,5-tetramethyl-2,3,6,7,8,8a-hexahydronaphthalene-1-carbothioate |
|---|---|
| PubChem CID | 132517231 |
| Molecular Formula | C17H28OS |
| Molecular Weight | 280.48 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | S-ethyl (1R,2S,8aR)-1,2,5,5-tetramethyl-2,3,6,7,8,8a-hexahydronaphthalene-1-carbothioate |
| SMILES | CCSC(=O)[C@@]1(C)[C@@H]2CCCC(C)(C)C2=CC[C@@H]1C |
| InChI | InChI=1S/C17H28OS/c1-6-19-15(18)17(5)12(2)9-10-13-14(17)8-7-11-16(13,3)4/h10,12,14H,6-9,11H2,1-5H3/t12-,14+,17+/m0/s1 |
| InChIKey | ZOBIGOMQYCGKLV-DXCKQFNASA-N |
| XLogP | 5.06 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.48 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|